C10H14ClF2N — CID 47002202
3,5-difluoro-N-(2-methylpropyl)aniline;hydrochloride (PubChem CID 47002202) has the molecular formula C10H14ClF2N and a molecular weight of 221.68 g/mol. Its IUPAC name is 3,5-difluoro-N-(2-methylpropyl)aniline;hydrochloride.
| Compound Name | 3,5-difluoro-N-(2-methylpropyl)aniline;hydrochloride |
|---|---|
| PubChem CID | 47002202 |
| Molecular Formula | C10H14ClF2N |
| Molecular Weight | 221.68 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 3,5-difluoro-N-(2-methylpropyl)aniline;hydrochloride |
| SMILES | CC(C)CNc1cc(F)cc(F)c1.Cl |
| InChI | InChI=1S/C10H13F2N.ClH/c1-7(2)6-13-10-4-8(11)3-9(12)5-10;/h3-5,7,13H,6H2,1-2H3;1H |
| InChIKey | KKHLQQYJBXRPGE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.68 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |