C10H13F2NO2 — CID 63686979
N-(2,2-dimethoxyethyl)-3,5-difluoroaniline (PubChem CID 63686979) has the molecular formula C10H13F2NO2 and a molecular weight of 217.22 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-3,5-difluoroaniline.
| Compound Name | N-(2,2-dimethoxyethyl)-3,5-difluoroaniline |
|---|---|
| PubChem CID | 63686979 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-3,5-difluoroaniline |
| SMILES | COC(CNc1cc(F)cc(F)c1)OC |
| InChI | InChI=1S/C10H13F2NO2/c1-14-10(15-2)6-13-9-4-7(11)3-8(12)5-9/h3-5,10,13H,6H2,1-2H3 |
| InChIKey | XPFLEVLQCLKTQN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|