C10H12F2N2O4 — CID 81310052
N-(2,2-dimethoxyethyl)-2,4-difluoro-6-nitroaniline (PubChem CID 81310052) has the molecular formula C10H12F2N2O4 and a molecular weight of 262.21 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2,4-difluoro-6-nitroaniline.
| Compound Name | N-(2,2-dimethoxyethyl)-2,4-difluoro-6-nitroaniline |
|---|---|
| PubChem CID | 81310052 |
| Molecular Formula | C10H12F2N2O4 |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2,4-difluoro-6-nitroaniline |
| SMILES | COC(CNc1c(F)cc(F)cc1[N+](=O)[O-])OC |
| InChI | InChI=1S/C10H12F2N2O4/c1-17-9(18-2)5-13-10-7(12)3-6(11)4-8(10)14(15)16/h3-4,9,13H,5H2,1-2H3 |
| InChIKey | KQFSCRGSSZKVCK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|