C12H14N4O6 — CID 102097958
N-(2,2-dimethoxyethyl)-5,7-dinitro-1H-indol-4-amine (PubChem CID 102097958) has the molecular formula C12H14N4O6 and a molecular weight of 310.27 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-5,7-dinitro-1H-indol-4-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-5,7-dinitro-1H-indol-4-amine |
|---|---|
| PubChem CID | 102097958 |
| Molecular Formula | C12H14N4O6 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-5,7-dinitro-1H-indol-4-amine |
| SMILES | COC(CNc1c([N+](=O)[O-])cc([N+](=O)[O-])c2[nH]ccc12)OC |
| InChI | InChI=1S/C12H14N4O6/c1-21-10(22-2)6-14-12-7-3-4-13-11(7)8(15(17)18)5-9(12)16(19)20/h3-5,10,13-14H,6H2,1-2H3 |
| InChIKey | JFJXZOAKFNROHX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 132.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|