C9H13FN2O2 — CID 106197172
N-(2,2-dimethoxyethyl)-2-fluoropyridin-4-amine (PubChem CID 106197172) has the molecular formula C9H13FN2O2 and a molecular weight of 200.21 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2-fluoropyridin-4-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-2-fluoropyridin-4-amine |
|---|---|
| PubChem CID | 106197172 |
| Molecular Formula | C9H13FN2O2 |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2-fluoropyridin-4-amine |
| SMILES | COC(CNc1ccnc(F)c1)OC |
| InChI | InChI=1S/C9H13FN2O2/c1-13-9(14-2)6-12-7-3-4-11-8(10)5-7/h3-5,9H,6H2,1-2H3,(H,11,12) |
| InChIKey | NUOOLABKVPXXDP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|