C10H13F3N2O2 — CID 82811775
N-(2,2-dimethoxyethyl)-6-(trifluoromethyl)pyridin-3-amine (PubChem CID 82811775) has the molecular formula C10H13F3N2O2 and a molecular weight of 250.22 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-6-(trifluoromethyl)pyridin-3-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-6-(trifluoromethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 82811775 |
| Molecular Formula | C10H13F3N2O2 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-6-(trifluoromethyl)pyridin-3-amine |
| SMILES | COC(CNc1ccc(C(F)(F)F)nc1)OC |
| InChI | InChI=1S/C10H13F3N2O2/c1-16-9(17-2)6-14-7-3-4-8(15-5-7)10(11,12)13/h3-5,9,14H,6H2,1-2H3 |
| InChIKey | RVOHXQZTJVGSCJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|