C8H12FN3O2 — CID 107389783
N-(2,2-dimethoxyethyl)-5-fluoropyrimidin-2-amine (PubChem CID 107389783) has the molecular formula C8H12FN3O2 and a molecular weight of 201.20 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-5-fluoropyrimidin-2-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 107389783 |
| Molecular Formula | C8H12FN3O2 |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-5-fluoropyrimidin-2-amine |
| SMILES | COC(CNc1ncc(F)cn1)OC |
| InChI | InChI=1S/C8H12FN3O2/c1-13-7(14-2)5-12-8-10-3-6(9)4-11-8/h3-4,7H,5H2,1-2H3,(H,10,11,12) |
| InChIKey | FDPXBSWNKWVRCP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|