C11H19FN4 — CID 106116387
N-(5-fluoropyrimidin-2-yl)-2-propylbutane-1,4-diamine (PubChem CID 106116387) has the molecular formula C11H19FN4 and a molecular weight of 226.30 g/mol. Its IUPAC name is N-(5-fluoropyrimidin-2-yl)-2-propylbutane-1,4-diamine.
| Compound Name | N-(5-fluoropyrimidin-2-yl)-2-propylbutane-1,4-diamine |
|---|---|
| PubChem CID | 106116387 |
| Molecular Formula | C11H19FN4 |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | N-(5-fluoropyrimidin-2-yl)-2-propylbutane-1,4-diamine |
| SMILES | CCCC(CCN)CNc1ncc(F)cn1 |
| InChI | InChI=1S/C11H19FN4/c1-2-3-9(4-5-13)6-14-11-15-7-10(12)8-16-11/h7-9H,2-6,13H2,1H3,(H,14,15,16) |
| InChIKey | JGSXFWFOCAFQJI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |