C13H23FN4O — CID 106118528
3-[[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]methyl]hexan-1-ol (PubChem CID 106118528) has the molecular formula C13H23FN4O and a molecular weight of 270.35 g/mol. Its IUPAC name is 3-[[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]methyl]hexan-1-ol.
| Compound Name | 3-[[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 106118528 |
| Molecular Formula | C13H23FN4O |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 3-[[[2-(ethylamino)-5-fluoropyrimidin-4-yl]amino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNc1nc(NCC)ncc1F |
| InChI | InChI=1S/C13H23FN4O/c1-3-5-10(6-7-19)8-16-12-11(14)9-17-13(18-12)15-4-2/h9-10,19H,3-8H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | HRTUKMLRSMGUDS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |