C9H10Cl2F2N2O3S — CID 84584788
1,3-dichloro-2-(difluoromethoxy)-5-(dimethylsulfamoylamino)benzene (PubChem CID 84584788) has the molecular formula C9H10Cl2F2N2O3S and a molecular weight of 335.16 g/mol. Its IUPAC name is 1,3-dichloro-2-(difluoromethoxy)-5-(dimethylsulfamoylamino)benzene.
| Compound Name | 1,3-dichloro-2-(difluoromethoxy)-5-(dimethylsulfamoylamino)benzene |
|---|---|
| PubChem CID | 84584788 |
| Molecular Formula | C9H10Cl2F2N2O3S |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 1,3-dichloro-2-(difluoromethoxy)-5-(dimethylsulfamoylamino)benzene |
| SMILES | CN(C)S(=O)(=O)Nc1cc(Cl)c(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2F2N2O3S/c1-15(2)19(16,17)14-5-3-6(10)8(7(11)4-5)18-9(12)13/h3-4,9,14H,1-2H3 |
| InChIKey | RXMJIJCUXKXECZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |