C12H17Cl2NO3S — CID 103521316
N-(3,5-dichloro-4-hydroxyphenyl)-3,3-dimethylbutane-1-sulfonamide (PubChem CID 103521316) has the molecular formula C12H17Cl2NO3S and a molecular weight of 326.25 g/mol. Its IUPAC name is N-(3,5-dichloro-4-hydroxyphenyl)-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-(3,5-dichloro-4-hydroxyphenyl)-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 103521316 |
| Molecular Formula | C12H17Cl2NO3S |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | N-(3,5-dichloro-4-hydroxyphenyl)-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CC(C)(C)CCS(=O)(=O)Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C12H17Cl2NO3S/c1-12(2,3)4-5-19(17,18)15-8-6-9(13)11(16)10(14)7-8/h6-7,15-16H,4-5H2,1-3H3 |
| InChIKey | GGJZVPHEDJGFOJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|