C13H19NO3S — CID 106912861
N-(4-formylphenyl)-3,3-dimethylbutane-1-sulfonamide (PubChem CID 106912861) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is N-(4-formylphenyl)-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-(4-formylphenyl)-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 106912861 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-(4-formylphenyl)-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CC(C)(C)CCS(=O)(=O)Nc1ccc(C=O)cc1 |
| InChI | InChI=1S/C13H19NO3S/c1-13(2,3)8-9-18(16,17)14-12-6-4-11(10-15)5-7-12/h4-7,10,14H,8-9H2,1-3H3 |
| InChIKey | PNVHUNIZKZXETD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|