C12H18INO2S — CID 103727880
N-(2-iodophenyl)-3,3-dimethylbutane-1-sulfonamide (PubChem CID 103727880) has the molecular formula C12H18INO2S and a molecular weight of 367.25 g/mol. Its IUPAC name is N-(2-iodophenyl)-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-(2-iodophenyl)-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 103727880 |
| Molecular Formula | C12H18INO2S |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | N-(2-iodophenyl)-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CC(C)(C)CCS(=O)(=O)Nc1ccccc1I |
| InChI | InChI=1S/C12H18INO2S/c1-12(2,3)8-9-17(15,16)14-11-7-5-4-6-10(11)13/h4-7,14H,8-9H2,1-3H3 |
| InChIKey | KKOZLSFCWZQXQQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|