C14H22N2O3S — CID 103521277
N-[2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]phenyl]-3,3-dimethylbutane-1-sulfonamide (PubChem CID 103521277) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is N-[2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]phenyl]-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-[2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]phenyl]-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 103521277 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-[2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]phenyl]-3,3-dimethylbutane-1-sulfonamide |
| SMILES | C/C(=N/O)c1ccccc1NS(=O)(=O)CCC(C)(C)C |
| InChI | InChI=1S/C14H22N2O3S/c1-11(15-17)12-7-5-6-8-13(12)16-20(18,19)10-9-14(2,3)4/h5-8,16-17H,9-10H2,1-4H3/b15-11- |
| InChIKey | CTLPAIUZSYKWRJ-PTNGSMBKSA-N |
| XLogP | 3.06 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|