C11H17FN2O2S — CID 103522016
N-(6-fluoro-2-pyridinyl)-3,3-dimethylbutane-1-sulfonamide (PubChem CID 103522016) has the molecular formula C11H17FN2O2S and a molecular weight of 260.33 g/mol. Its IUPAC name is N-(6-fluoro-2-pyridinyl)-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-(6-fluoro-2-pyridinyl)-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 103522016 |
| Molecular Formula | C11H17FN2O2S |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | N-(6-fluoro-2-pyridinyl)-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CC(C)(C)CCS(=O)(=O)Nc1cccc(F)n1 |
| InChI | InChI=1S/C11H17FN2O2S/c1-11(2,3)7-8-17(15,16)14-10-6-4-5-9(12)13-10/h4-6H,7-8H2,1-3H3,(H,13,14) |
| InChIKey | KZFOFMXCAMJEOV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|