C9H8Cl2N2O3S — CID 82884315
1-cyano-N-(3,5-dichloro-4-hydroxyphenyl)ethanesulfonamide (PubChem CID 82884315) has the molecular formula C9H8Cl2N2O3S and a molecular weight of 295.15 g/mol. Its IUPAC name is 1-cyano-N-(3,5-dichloro-4-hydroxyphenyl)ethanesulfonamide.
| Compound Name | 1-cyano-N-(3,5-dichloro-4-hydroxyphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 82884315 |
| Molecular Formula | C9H8Cl2N2O3S |
| Molecular Weight | 295.15 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | 1-cyano-N-(3,5-dichloro-4-hydroxyphenyl)ethanesulfonamide |
| SMILES | CC(C#N)S(=O)(=O)Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C9H8Cl2N2O3S/c1-5(4-12)17(15,16)13-6-2-7(10)9(14)8(11)3-6/h2-3,5,13-14H,1H3 |
| InChIKey | OBBBOGNFAGSBLF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.15 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|