C10H14Cl2N2O3S — CID 114815573
2,6-dichloro-4-(2-methylpropylsulfamoylamino)phenol (PubChem CID 114815573) has the molecular formula C10H14Cl2N2O3S and a molecular weight of 313.21 g/mol. Its IUPAC name is 2,6-dichloro-4-(2-methylpropylsulfamoylamino)phenol.
| Compound Name | 2,6-dichloro-4-(2-methylpropylsulfamoylamino)phenol |
|---|---|
| PubChem CID | 114815573 |
| Molecular Formula | C10H14Cl2N2O3S |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 2,6-dichloro-4-(2-methylpropylsulfamoylamino)phenol |
| SMILES | CC(C)CNS(=O)(=O)Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C10H14Cl2N2O3S/c1-6(2)5-13-18(16,17)14-7-3-8(11)10(15)9(12)4-7/h3-4,6,13-15H,5H2,1-2H3 |
| InChIKey | GKDGZTXOESYRIL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|