C14H8Cl2F2N2O — CID 107679307
4-[(3,5-dichloro-4-hydroxyanilino)methyl]-3,5-difluorobenzonitrile (PubChem CID 107679307) has the molecular formula C14H8Cl2F2N2O and a molecular weight of 329.13 g/mol. Its IUPAC name is 4-[(3,5-dichloro-4-hydroxyanilino)methyl]-3,5-difluorobenzonitrile.
| Compound Name | 4-[(3,5-dichloro-4-hydroxyanilino)methyl]-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 107679307 |
| Molecular Formula | C14H8Cl2F2N2O |
| Molecular Weight | 329.13 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 4-[(3,5-dichloro-4-hydroxyanilino)methyl]-3,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(CNc2cc(Cl)c(O)c(Cl)c2)c(F)c1 |
| InChI | InChI=1S/C14H8Cl2F2N2O/c15-10-3-8(4-11(16)14(10)21)20-6-9-12(17)1-7(5-19)2-13(9)18/h1-4,20-21H,6H2 |
| InChIKey | VTJLSORPQLBNAO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.13 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|