C14H9ClF2N2 — CID 107037544
4-[(4-chloroanilino)methyl]-3,5-difluorobenzonitrile (PubChem CID 107037544) has the molecular formula C14H9ClF2N2 and a molecular weight of 278.69 g/mol. Its IUPAC name is 4-[(4-chloroanilino)methyl]-3,5-difluorobenzonitrile.
| Compound Name | 4-[(4-chloroanilino)methyl]-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 107037544 |
| Molecular Formula | C14H9ClF2N2 |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 4-[(4-chloroanilino)methyl]-3,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(CNc2ccc(Cl)cc2)c(F)c1 |
| InChI | InChI=1S/C14H9ClF2N2/c15-10-1-3-11(4-2-10)19-8-12-13(16)5-9(7-18)6-14(12)17/h1-6,19H,8H2 |
| InChIKey | WXGPWGHLQXMWKH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |