C13H7BrClF2N3 — CID 107143611
4-[[(5-bromo-6-chloro-3-pyridinyl)amino]methyl]-3,5-difluorobenzonitrile (PubChem CID 107143611) has the molecular formula C13H7BrClF2N3 and a molecular weight of 358.57 g/mol. Its IUPAC name is 4-[[(5-bromo-6-chloro-3-pyridinyl)amino]methyl]-3,5-difluorobenzonitrile.
| Compound Name | 4-[[(5-bromo-6-chloro-3-pyridinyl)amino]methyl]-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 107143611 |
| Molecular Formula | C13H7BrClF2N3 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 356.95 |
| IUPAC Name | 4-[[(5-bromo-6-chloro-3-pyridinyl)amino]methyl]-3,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(CNc2cnc(Cl)c(Br)c2)c(F)c1 |
| InChI | InChI=1S/C13H7BrClF2N3/c14-10-3-8(5-20-13(10)15)19-6-9-11(16)1-7(4-18)2-12(9)17/h1-3,5,19H,6H2 |
| InChIKey | DLSUQQCLBJREAZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|