C15H11BrF2N2 — CID 107038807
4-[(2-bromo-5-methylanilino)methyl]-3,5-difluorobenzonitrile (PubChem CID 107038807) has the molecular formula C15H11BrF2N2 and a molecular weight of 337.17 g/mol. Its IUPAC name is 4-[(2-bromo-5-methylanilino)methyl]-3,5-difluorobenzonitrile.
| Compound Name | 4-[(2-bromo-5-methylanilino)methyl]-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 107038807 |
| Molecular Formula | C15H11BrF2N2 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 4-[(2-bromo-5-methylanilino)methyl]-3,5-difluorobenzonitrile |
| SMILES | Cc1ccc(Br)c(NCc2c(F)cc(C#N)cc2F)c1 |
| InChI | InChI=1S/C15H11BrF2N2/c1-9-2-3-12(16)15(4-9)20-8-11-13(17)5-10(7-19)6-14(11)18/h2-6,20H,8H2,1H3 |
| InChIKey | RYSOXCXYYPBCCZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |