C16H14F2N2O — CID 107038342
3,5-difluoro-4-[(4-methoxy-2-methylanilino)methyl]benzonitrile (PubChem CID 107038342) has the molecular formula C16H14F2N2O and a molecular weight of 288.30 g/mol. Its IUPAC name is 3,5-difluoro-4-[(4-methoxy-2-methylanilino)methyl]benzonitrile.
| Compound Name | 3,5-difluoro-4-[(4-methoxy-2-methylanilino)methyl]benzonitrile |
|---|---|
| PubChem CID | 107038342 |
| Molecular Formula | C16H14F2N2O |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3,5-difluoro-4-[(4-methoxy-2-methylanilino)methyl]benzonitrile |
| SMILES | COc1ccc(NCc2c(F)cc(C#N)cc2F)c(C)c1 |
| InChI | InChI=1S/C16H14F2N2O/c1-10-5-12(21-2)3-4-16(10)20-9-13-14(17)6-11(8-19)7-15(13)18/h3-7,20H,9H2,1-2H3 |
| InChIKey | KDLPGEIZVWWVEW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|