C7H7ClF3N — CID 86064922
(3,4,5-trifluorophenyl)methanamine;hydrochloride (PubChem CID 86064922) has the molecular formula C7H7ClF3N and a molecular weight of 197.59 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl)methanamine;hydrochloride.
| Compound Name | (3,4,5-trifluorophenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 86064922 |
| Molecular Formula | C7H7ClF3N |
| Molecular Weight | 197.59 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | (3,4,5-trifluorophenyl)methanamine;hydrochloride |
| SMILES | Cl.NCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C7H6F3N.ClH/c8-5-1-4(3-11)2-6(9)7(5)10;/h1-2H,3,11H2;1H |
| InChIKey | ZKUGEINHEJHUBQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.59 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|