C8H9F2NS — CID 63814041
(3,5-difluoro-4-methylsulfanylphenyl)methanamine (PubChem CID 63814041) has the molecular formula C8H9F2NS and a molecular weight of 189.23 g/mol. Its IUPAC name is (3,5-difluoro-4-methylsulfanylphenyl)methanamine.
| Compound Name | (3,5-difluoro-4-methylsulfanylphenyl)methanamine |
|---|---|
| PubChem CID | 63814041 |
| Molecular Formula | C8H9F2NS |
| Molecular Weight | 189.23 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | (3,5-difluoro-4-methylsulfanylphenyl)methanamine |
| SMILES | CSc1c(F)cc(CN)cc1F |
| InChI | InChI=1S/C8H9F2NS/c1-12-8-6(9)2-5(4-11)3-7(8)10/h2-3H,4,11H2,1H3 |
| InChIKey | XERIQXOCUZZHBA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |