C9H11F2NS — CID 63818519
2-(3,5-difluoro-4-methylsulfanylphenyl)ethanamine (PubChem CID 63818519) has the molecular formula C9H11F2NS and a molecular weight of 203.26 g/mol. Its IUPAC name is 2-(3,5-difluoro-4-methylsulfanylphenyl)ethanamine.
| Compound Name | 2-(3,5-difluoro-4-methylsulfanylphenyl)ethanamine |
|---|---|
| PubChem CID | 63818519 |
| Molecular Formula | C9H11F2NS |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 2-(3,5-difluoro-4-methylsulfanylphenyl)ethanamine |
| SMILES | CSc1c(F)cc(CCN)cc1F |
| InChI | InChI=1S/C9H11F2NS/c1-13-9-7(10)4-6(2-3-12)5-8(9)11/h4-5H,2-3,12H2,1H3 |
| InChIKey | HRNLEBVHNPZYFJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |