About 4-(aminomethyl)-2,6-difluoro-N-propylaniline
4-(aminomethyl)-2,6-difluoro-N-propylaniline (PubChem CID 81293797) has the molecular formula C10H14F2N2
and a molecular weight of 200.23 g/mol. Its IUPAC name is 4-(aminomethyl)-2,6-difluoro-N-propylaniline.
Molecular Properties
| Compound Name | 4-(aminomethyl)-2,6-difluoro-N-propylaniline |
| PubChem CID | 81293797 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 4-(aminomethyl)-2,6-difluoro-N-propylaniline |
| SMILES | CCCNc1c(F)cc(CN)cc1F |
| InChI | InChI=1S/C10H14F2N2/c1-2-3-14-10-8(11)4-7(6-13)5-9(10)12/h4-5,14H,2-3,6,13H2,1H3 |
| InChIKey | GALMDYPFVNTXOU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(aminomethyl)-2,6-difluoro-N-propylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-2,6-difluoro-N-propylaniline?
The IUPAC name of 4-(aminomethyl)-2,6-difluoro-N-propylaniline (CID 81293797) is 4-(aminomethyl)-2,6-difluoro-N-propylaniline.
What is the SMILES notation for 4-(aminomethyl)-2,6-difluoro-N-propylaniline?
The canonical SMILES for 4-(aminomethyl)-2,6-difluoro-N-propylaniline is CCCNc1c(F)cc(CN)cc1F.
What is the InChIKey of 4-(aminomethyl)-2,6-difluoro-N-propylaniline?
The InChIKey is GALMDYPFVNTXOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2N2/c1-2-3-14-10-8(11)4-7(6-13)5-9(10)12/h4-5,14H,2-3,6,13H2,1H3.
What are the key properties of 4-(aminomethyl)-2,6-difluoro-N-propylaniline?
4-(aminomethyl)-2,6-difluoro-N-propylaniline has a molecular weight of 200.23 g/mol, XLogP of 2.25, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-2,6-difluoro-N-propylaniline is sourced from PubChem (CID 81293797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).