C12H17F2NO — CID 81293219
[3,5-difluoro-4-(2-methylbutan-2-yloxy)phenyl]methanamine (PubChem CID 81293219) has the molecular formula C12H17F2NO and a molecular weight of 229.27 g/mol. Its IUPAC name is [3,5-difluoro-4-(2-methylbutan-2-yloxy)phenyl]methanamine.
| Compound Name | [3,5-difluoro-4-(2-methylbutan-2-yloxy)phenyl]methanamine |
|---|---|
| PubChem CID | 81293219 |
| Molecular Formula | C12H17F2NO |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | [3,5-difluoro-4-(2-methylbutan-2-yloxy)phenyl]methanamine |
| SMILES | CCC(C)(C)Oc1c(F)cc(CN)cc1F |
| InChI | InChI=1S/C12H17F2NO/c1-4-12(2,3)16-11-9(13)5-8(7-15)6-10(11)14/h5-6H,4,7,15H2,1-3H3 |
| InChIKey | KXIRMQGOPMLSCN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |