C7H8FN3O2S2 — CID 169359323
(2-fluoro-6-sulfamoylphenyl)thiourea (PubChem CID 169359323) has the molecular formula C7H8FN3O2S2 and a molecular weight of 249.29 g/mol. Its IUPAC name is (2-fluoro-6-sulfamoylphenyl)thiourea.
| Compound Name | (2-fluoro-6-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 169359323 |
| Molecular Formula | C7H8FN3O2S2 |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | (2-fluoro-6-sulfamoylphenyl)thiourea |
| SMILES | NC(=S)Nc1c(F)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C7H8FN3O2S2/c8-4-2-1-3-5(15(10,12)13)6(4)11-7(9)14/h1-3H,(H3,9,11,14)(H2,10,12,13) |
| InChIKey | ICAKATGBBNVRMT-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|