C15H12F4N2O4S2 — CID 42643641
3-fluoro-2-[[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]sulfonylamino]benzenesulfonamide (PubChem CID 42643641) has the molecular formula C15H12F4N2O4S2 and a molecular weight of 424.40 g/mol. Its IUPAC name is 3-fluoro-2-[[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]sulfonylamino]benzenesulfonamide.
| Compound Name | 3-fluoro-2-[[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 42643641 |
| Molecular Formula | C15H12F4N2O4S2 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | 3-fluoro-2-[[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]sulfonylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(F)c1NS(=O)(=O)/C=C/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H12F4N2O4S2/c16-12-5-2-6-13(27(20,24)25)14(12)21-26(22,23)8-7-10-3-1-4-11(9-10)15(17,18)19/h1-9,21H,(H2,20,24,25)/b8-7+ |
| InChIKey | MEPCNOKPFQVUEG-BQYQJAHWSA-N |
| XLogP | 2.90 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |