C16H15F3N2O4S2 — CID 68780541
5-methyl-2-[2-[4-(trifluoromethyl)phenyl]ethenylsulfonylamino]benzenesulfonamide (PubChem CID 68780541) has the molecular formula C16H15F3N2O4S2 and a molecular weight of 420.43 g/mol. Its IUPAC name is 5-methyl-2-[2-[4-(trifluoromethyl)phenyl]ethenylsulfonylamino]benzenesulfonamide.
| Compound Name | 5-methyl-2-[2-[4-(trifluoromethyl)phenyl]ethenylsulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 68780541 |
| Molecular Formula | C16H15F3N2O4S2 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 5-methyl-2-[2-[4-(trifluoromethyl)phenyl]ethenylsulfonylamino]benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)C=Cc2ccc(C(F)(F)F)cc2)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C16H15F3N2O4S2/c1-11-2-7-14(15(10-11)27(20,24)25)21-26(22,23)9-8-12-3-5-13(6-4-12)16(17,18)19/h2-10,21H,1H3,(H2,20,24,25) |
| InChIKey | RUICTWDYCKTARZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |