C18H15FN2O5S2 — CID 42646502
5-fluoro-2-[[(E)-2-[4-(furan-2-yl)phenyl]ethenyl]sulfonylamino]benzenesulfonamide (PubChem CID 42646502) has the molecular formula C18H15FN2O5S2 and a molecular weight of 422.46 g/mol. Its IUPAC name is 5-fluoro-2-[[(E)-2-[4-(furan-2-yl)phenyl]ethenyl]sulfonylamino]benzenesulfonamide.
| Compound Name | 5-fluoro-2-[[(E)-2-[4-(furan-2-yl)phenyl]ethenyl]sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 42646502 |
| Molecular Formula | C18H15FN2O5S2 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 5-fluoro-2-[[(E)-2-[4-(furan-2-yl)phenyl]ethenyl]sulfonylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(F)ccc1NS(=O)(=O)/C=C/c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C18H15FN2O5S2/c19-15-7-8-16(18(12-15)28(20,24)25)21-27(22,23)11-9-13-3-5-14(6-4-13)17-2-1-10-26-17/h1-12,21H,(H2,20,24,25)/b11-9+ |
| InChIKey | SDYMTGFQIZOEHK-PKNBQFBNSA-N |
| XLogP | 3.15 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |