C14H12ClFN2O4S2 — CID 76869846
4-[2-(4-chlorophenyl)ethenylsulfonylamino]-3-fluorobenzenesulfonamide (PubChem CID 76869846) has the molecular formula C14H12ClFN2O4S2 and a molecular weight of 390.85 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)ethenylsulfonylamino]-3-fluorobenzenesulfonamide.
| Compound Name | 4-[2-(4-chlorophenyl)ethenylsulfonylamino]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 76869846 |
| Molecular Formula | C14H12ClFN2O4S2 |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | 4-[2-(4-chlorophenyl)ethenylsulfonylamino]-3-fluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NS(=O)(=O)C=Cc2ccc(Cl)cc2)c(F)c1 |
| InChI | InChI=1S/C14H12ClFN2O4S2/c15-11-3-1-10(2-4-11)7-8-23(19,20)18-14-6-5-12(9-13(14)16)24(17,21)22/h1-9,18H,(H2,17,21,22) |
| InChIKey | KNGXRAMGSASQNV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |