C15H13ClF2N2O5S2 — CID 68782626
4-chloro-2-[2-[4-(difluoromethoxy)phenyl]ethenylsulfonylamino]benzenesulfonamide (PubChem CID 68782626) has the molecular formula C15H13ClF2N2O5S2 and a molecular weight of 438.86 g/mol. Its IUPAC name is 4-chloro-2-[2-[4-(difluoromethoxy)phenyl]ethenylsulfonylamino]benzenesulfonamide.
| Compound Name | 4-chloro-2-[2-[4-(difluoromethoxy)phenyl]ethenylsulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 68782626 |
| Molecular Formula | C15H13ClF2N2O5S2 |
| Molecular Weight | 438.86 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | 4-chloro-2-[2-[4-(difluoromethoxy)phenyl]ethenylsulfonylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Cl)cc1NS(=O)(=O)C=Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H13ClF2N2O5S2/c16-11-3-6-14(27(19,23)24)13(9-11)20-26(21,22)8-7-10-1-4-12(5-2-10)25-15(17)18/h1-9,15,20H,(H2,19,23,24) |
| InChIKey | SHYNMFKFTLOZMY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.86 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |