C10H11F2NO3S — CID 117412069
3-amino-1-(2,3-difluoro-5-methylsulfonylphenyl)propan-1-one (PubChem CID 117412069) has the molecular formula C10H11F2NO3S and a molecular weight of 263.26 g/mol. Its IUPAC name is 3-amino-1-(2,3-difluoro-5-methylsulfonylphenyl)propan-1-one.
| Compound Name | 3-amino-1-(2,3-difluoro-5-methylsulfonylphenyl)propan-1-one |
|---|---|
| PubChem CID | 117412069 |
| Molecular Formula | C10H11F2NO3S |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 3-amino-1-(2,3-difluoro-5-methylsulfonylphenyl)propan-1-one |
| SMILES | CS(=O)(=O)c1cc(F)c(F)c(C(=O)CCN)c1 |
| InChI | InChI=1S/C10H11F2NO3S/c1-17(15,16)6-4-7(9(14)2-3-13)10(12)8(11)5-6/h4-5H,2-3,13H2,1H3 |
| InChIKey | RHOHDLJASBTGRO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |