C9H7BrF3NO — CID 117452875
3-amino-1-(5-bromo-2,3,4-trifluorophenyl)propan-1-one (PubChem CID 117452875) has the molecular formula C9H7BrF3NO and a molecular weight of 282.06 g/mol. Its IUPAC name is 3-amino-1-(5-bromo-2,3,4-trifluorophenyl)propan-1-one.
| Compound Name | 3-amino-1-(5-bromo-2,3,4-trifluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 117452875 |
| Molecular Formula | C9H7BrF3NO |
| Molecular Weight | 282.06 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | 3-amino-1-(5-bromo-2,3,4-trifluorophenyl)propan-1-one |
| SMILES | NCCC(=O)c1cc(Br)c(F)c(F)c1F |
| InChI | InChI=1S/C9H7BrF3NO/c10-5-3-4(6(15)1-2-14)7(11)9(13)8(5)12/h3H,1-2,14H2 |
| InChIKey | OJGPEVJEDMFQQD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.06 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|