C13H17FN2O3 — CID 143773952
tert-butyl N-[2-(aminomethyl)-5-fluoro-4-formylphenyl]carbamate (PubChem CID 143773952) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is tert-butyl N-[2-(aminomethyl)-5-fluoro-4-formylphenyl]carbamate.
| Compound Name | tert-butyl N-[2-(aminomethyl)-5-fluoro-4-formylphenyl]carbamate |
|---|---|
| PubChem CID | 143773952 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | tert-butyl N-[2-(aminomethyl)-5-fluoro-4-formylphenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(F)c(C=O)cc1CN |
| InChI | InChI=1S/C13H17FN2O3/c1-13(2,3)19-12(18)16-11-5-10(14)9(7-17)4-8(11)6-15/h4-5,7H,6,15H2,1-3H3,(H,16,18) |
| InChIKey | YJYWOABLNWQEOP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|