C13H16FNO4 — CID 84808638
tert-butyl N-(5-fluoro-3-formyl-2-hydroxy-4-methylphenyl)carbamate (PubChem CID 84808638) has the molecular formula C13H16FNO4 and a molecular weight of 269.27 g/mol. Its IUPAC name is tert-butyl N-(5-fluoro-3-formyl-2-hydroxy-4-methylphenyl)carbamate.
| Compound Name | tert-butyl N-(5-fluoro-3-formyl-2-hydroxy-4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 84808638 |
| Molecular Formula | C13H16FNO4 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | tert-butyl N-(5-fluoro-3-formyl-2-hydroxy-4-methylphenyl)carbamate |
| SMILES | Cc1c(F)cc(NC(=O)OC(C)(C)C)c(O)c1C=O |
| InChI | InChI=1S/C13H16FNO4/c1-7-8(6-16)11(17)10(5-9(7)14)15-12(18)19-13(2,3)4/h5-6,17H,1-4H3,(H,15,18) |
| InChIKey | UTDZJOPZLKDOKF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|