C21H13F5O — CID 19967831
1-[4-[4-[(2,3,4,5,6-pentafluorophenyl)methyl]phenyl]phenyl]ethanone (PubChem CID 19967831) has the molecular formula C21H13F5O and a molecular weight of 376.32 g/mol. Its IUPAC name is 1-[4-[4-[(2,3,4,5,6-pentafluorophenyl)methyl]phenyl]phenyl]ethanone.
| Compound Name | 1-[4-[4-[(2,3,4,5,6-pentafluorophenyl)methyl]phenyl]phenyl]ethanone |
|---|---|
| PubChem CID | 19967831 |
| Molecular Formula | C21H13F5O |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 1-[4-[4-[(2,3,4,5,6-pentafluorophenyl)methyl]phenyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(-c2ccc(Cc3c(F)c(F)c(F)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C21H13F5O/c1-11(27)13-6-8-15(9-7-13)14-4-2-12(3-5-14)10-16-17(22)19(24)21(26)20(25)18(16)23/h2-9H,10H2,1H3 |
| InChIKey | FHXZRUJWFHKWBK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|