C16H10F8O — CID 21026826
1,3-difluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-(4-methylphenyl)benzene (PubChem CID 21026826) has the molecular formula C16H10F8O and a molecular weight of 370.24 g/mol. Its IUPAC name is 1,3-difluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-(4-methylphenyl)benzene.
| Compound Name | 1,3-difluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-(4-methylphenyl)benzene |
|---|---|
| PubChem CID | 21026826 |
| Molecular Formula | C16H10F8O |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 1,3-difluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-(4-methylphenyl)benzene |
| SMILES | Cc1ccc(-c2cc(F)c(OC(F)(F)C(F)C(F)(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C16H10F8O/c1-8-2-4-9(5-3-8)10-6-11(17)13(12(18)7-10)25-16(23,24)14(19)15(20,21)22/h2-7,14H,1H3 |
| InChIKey | WKRRXVSXWSCWSF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |