C20H17F7O — CID 18344011
1,3-difluoro-5-[4-(4-fluorocyclohexyl)phenyl]-2-(1,1,2,2-tetrafluoroethoxy)benzene (PubChem CID 18344011) has the molecular formula C20H17F7O and a molecular weight of 406.34 g/mol. Its IUPAC name is 1,3-difluoro-5-[4-(4-fluorocyclohexyl)phenyl]-2-(1,1,2,2-tetrafluoroethoxy)benzene.
| Compound Name | 1,3-difluoro-5-[4-(4-fluorocyclohexyl)phenyl]-2-(1,1,2,2-tetrafluoroethoxy)benzene |
|---|---|
| PubChem CID | 18344011 |
| Molecular Formula | C20H17F7O |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 1,3-difluoro-5-[4-(4-fluorocyclohexyl)phenyl]-2-(1,1,2,2-tetrafluoroethoxy)benzene |
| SMILES | Fc1cc(-c2ccc(C3CCC(F)CC3)cc2)cc(F)c1OC(F)(F)C(F)F |
| InChI | InChI=1S/C20H17F7O/c21-15-7-5-12(6-8-15)11-1-3-13(4-2-11)14-9-16(22)18(17(23)10-14)28-20(26,27)19(24)25/h1-4,9-10,12,15,19H,5-8H2 |
| InChIKey | PABKYPCBBRAXKK-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|