C38H32F12O2 — CID 59328902
2-[[4-[3,5-difluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluoro-5-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]benzene (PubChem CID 59328902) has the molecular formula C38H32F12O2 and a molecular weight of 748.65 g/mol. Its IUPAC name is 2-[[4-[3,5-difluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluoro-5-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]benzene.
| Compound Name | 2-[[4-[3,5-difluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluoro-5-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 59328902 |
| Molecular Formula | C38H32F12O2 |
| Molecular Weight | 748.65 g/mol |
| Exact Mass | 748.22 |
| IUPAC Name | 2-[[4-[3,5-difluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluoro-5-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]benzene |
| SMILES | CCCCCC1CCC(c2ccc(-c3cc(F)c(C(F)(F)Oc4ccc(-c5cc(F)c(OC(F)(F)C(F)F)c(F)c5)c(F)c4)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C38H32F12O2/c1-2-3-4-5-20-6-8-21(9-7-20)22-10-12-26(28(39)14-22)23-15-30(41)34(31(42)16-23)37(47,48)51-25-11-13-27(29(40)19-25)24-17-32(43)35(33(44)18-24)52-38(49,50)36(45)46/h10-21,36H,2-9H2,1H3 |
| InChIKey | WGXRBHNDQHTILN-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.65 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|