C37H33F6NO — CID 59328707
4-[4-[[2,6-difluoro-4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-difluoromethoxy]-2-fluorophenyl]benzonitrile (PubChem CID 59328707) has the molecular formula C37H33F6NO and a molecular weight of 621.67 g/mol. Its IUPAC name is 4-[4-[[2,6-difluoro-4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-difluoromethoxy]-2-fluorophenyl]benzonitrile.
| Compound Name | 4-[4-[[2,6-difluoro-4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-difluoromethoxy]-2-fluorophenyl]benzonitrile |
|---|---|
| PubChem CID | 59328707 |
| Molecular Formula | C37H33F6NO |
| Molecular Weight | 621.67 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | 4-[4-[[2,6-difluoro-4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-difluoromethoxy]-2-fluorophenyl]benzonitrile |
| SMILES | CCCCCC1CCC(c2ccc(-c3cc(F)c(C(F)(F)Oc4ccc(-c5ccc(C#N)cc5)c(F)c4)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C37H33F6NO/c1-2-3-4-5-23-6-10-25(11-7-23)27-14-16-31(32(38)18-27)28-19-34(40)36(35(41)20-28)37(42,43)45-29-15-17-30(33(39)21-29)26-12-8-24(22-44)9-13-26/h8-9,12-21,23,25H,2-7,10-11H2,1H3 |
| InChIKey | MIYGCWRDGRIJBI-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.67 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|