C24H24F8O2 — CID 54167691
1,3-difluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-[4-[4-(2-methoxyethyl)cyclohexyl]phenyl]benzene (PubChem CID 54167691) has the molecular formula C24H24F8O2 and a molecular weight of 496.44 g/mol. Its IUPAC name is 1,3-difluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-[4-[4-(2-methoxyethyl)cyclohexyl]phenyl]benzene.
| Compound Name | 1,3-difluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-[4-[4-(2-methoxyethyl)cyclohexyl]phenyl]benzene |
|---|---|
| PubChem CID | 54167691 |
| Molecular Formula | C24H24F8O2 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 1,3-difluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-[4-[4-(2-methoxyethyl)cyclohexyl]phenyl]benzene |
| SMILES | COCCC1CCC(c2ccc(-c3cc(F)c(OC(F)(F)C(F)C(F)(F)F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C24H24F8O2/c1-33-11-10-14-2-4-15(5-3-14)16-6-8-17(9-7-16)18-12-19(25)21(20(26)13-18)34-24(31,32)22(27)23(28,29)30/h6-9,12-15,22H,2-5,10-11H2,1H3 |
| InChIKey | OSUMYERVJWECJS-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |