C25H28F6O2 — CID 54515856
1-[4-(2-ethoxyethyl)cyclohexyl]-4-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]benzene (PubChem CID 54515856) has the molecular formula C25H28F6O2 and a molecular weight of 474.49 g/mol. Its IUPAC name is 1-[4-(2-ethoxyethyl)cyclohexyl]-4-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]benzene.
| Compound Name | 1-[4-(2-ethoxyethyl)cyclohexyl]-4-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]benzene |
|---|---|
| PubChem CID | 54515856 |
| Molecular Formula | C25H28F6O2 |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 1-[4-(2-ethoxyethyl)cyclohexyl]-4-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]benzene |
| SMILES | CCOCCC1CCC(c2ccc(-c3ccc(OC(F)(F)C(F)C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C25H28F6O2/c1-2-32-16-15-17-3-5-18(6-4-17)19-7-9-20(10-8-19)21-11-13-22(14-12-21)33-25(30,31)23(26)24(27,28)29/h7-14,17-18,23H,2-6,15-16H2,1H3 |
| InChIKey | YMIZIAYXEIVLQW-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|