C24H26F6O3 — CID 22080163
1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[4-[4-(1-methoxyethoxy)cyclohexyl]phenyl]benzene (PubChem CID 22080163) has the molecular formula C24H26F6O3 and a molecular weight of 476.46 g/mol. Its IUPAC name is 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[4-[4-(1-methoxyethoxy)cyclohexyl]phenyl]benzene.
| Compound Name | 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[4-[4-(1-methoxyethoxy)cyclohexyl]phenyl]benzene |
|---|---|
| PubChem CID | 22080163 |
| Molecular Formula | C24H26F6O3 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[4-[4-(1-methoxyethoxy)cyclohexyl]phenyl]benzene |
| SMILES | COC(C)OC1CCC(c2ccc(-c3ccc(OC(F)(F)C(F)C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C24H26F6O3/c1-15(31-2)32-20-11-7-18(8-12-20)16-3-5-17(6-4-16)19-9-13-21(14-10-19)33-24(29,30)22(25)23(26,27)28/h3-6,9-10,13-15,18,20,22H,7-8,11-12H2,1-2H3 |
| InChIKey | SQRMKZXKNXISCU-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|