C24H24F8O — CID 22080320
1,3-difluoro-2-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-5-(4-propylcyclohexyl)benzene (PubChem CID 22080320) has the molecular formula C24H24F8O and a molecular weight of 480.44 g/mol. Its IUPAC name is 1,3-difluoro-2-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-5-(4-propylcyclohexyl)benzene.
| Compound Name | 1,3-difluoro-2-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-5-(4-propylcyclohexyl)benzene |
|---|---|
| PubChem CID | 22080320 |
| Molecular Formula | C24H24F8O |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 1,3-difluoro-2-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-5-(4-propylcyclohexyl)benzene |
| SMILES | CCCC1CCC(c2cc(F)c(-c3ccc(OC(F)(F)C(F)C(F)(F)F)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C24H24F8O/c1-2-3-14-4-6-15(7-5-14)17-12-19(25)21(20(26)13-17)16-8-10-18(11-9-16)33-24(31,32)22(27)23(28,29)30/h8-15,22H,2-7H2,1H3 |
| InChIKey | GMWKCYQCPKVHLP-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |