C27H29F7O — CID 54176052
4-(4-butylcyclohexyl)-2-fluoro-1-[2-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]ethenyl]benzene (PubChem CID 54176052) has the molecular formula C27H29F7O and a molecular weight of 502.51 g/mol. Its IUPAC name is 4-(4-butylcyclohexyl)-2-fluoro-1-[2-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]ethenyl]benzene.
| Compound Name | 4-(4-butylcyclohexyl)-2-fluoro-1-[2-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 54176052 |
| Molecular Formula | C27H29F7O |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 4-(4-butylcyclohexyl)-2-fluoro-1-[2-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]ethenyl]benzene |
| SMILES | CCCCC1CCC(c2ccc(C=Cc3ccc(OC(F)(F)C(F)C(F)(F)F)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C27H29F7O/c1-2-3-4-18-5-10-20(11-6-18)22-14-13-21(24(28)17-22)12-7-19-8-15-23(16-9-19)35-27(33,34)25(29)26(30,31)32/h7-9,12-18,20,25H,2-6,10-11H2,1H3 |
| InChIKey | OYLDDLQFEYCPBF-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|