C25H24F10O3 — CID 22080080
2-[3,5-difluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-1,3-difluoro-5-[2-[4-(methoxymethoxy)cyclohexyl]ethyl]benzene (PubChem CID 22080080) has the molecular formula C25H24F10O3 and a molecular weight of 562.44 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-1,3-difluoro-5-[2-[4-(methoxymethoxy)cyclohexyl]ethyl]benzene.
| Compound Name | 2-[3,5-difluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-1,3-difluoro-5-[2-[4-(methoxymethoxy)cyclohexyl]ethyl]benzene |
|---|---|
| PubChem CID | 22080080 |
| Molecular Formula | C25H24F10O3 |
| Molecular Weight | 562.44 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | 2-[3,5-difluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-1,3-difluoro-5-[2-[4-(methoxymethoxy)cyclohexyl]ethyl]benzene |
| SMILES | COCOC1CCC(CCc2cc(F)c(-c3cc(F)c(OC(F)(F)C(F)C(F)(F)F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C25H24F10O3/c1-36-12-37-16-6-4-13(5-7-16)2-3-14-8-17(26)21(18(27)9-14)15-10-19(28)22(20(29)11-15)38-25(34,35)23(30)24(31,32)33/h8-11,13,16,23H,2-7,12H2,1H3 |
| InChIKey | LZHQNMRJYXGLSV-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.44 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|