C21H21F4Y+2 — CID 18720833
2-(3,5-difluorobenzene-4-id-1-yl)-1,3-difluoro-5-[2-(4-methylcyclohexyl)ethyl]benzene;yttrium(3+) (PubChem CID 18720833) has the molecular formula C21H21F4Y+2 and a molecular weight of 438.30 g/mol. Its IUPAC name is 2-(3,5-difluorobenzene-4-id-1-yl)-1,3-difluoro-5-[2-(4-methylcyclohexyl)ethyl]benzene;yttrium(3+).
| Compound Name | 2-(3,5-difluorobenzene-4-id-1-yl)-1,3-difluoro-5-[2-(4-methylcyclohexyl)ethyl]benzene;yttrium(3+) |
|---|---|
| PubChem CID | 18720833 |
| Molecular Formula | C21H21F4Y+2 |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 2-(3,5-difluorobenzene-4-id-1-yl)-1,3-difluoro-5-[2-(4-methylcyclohexyl)ethyl]benzene;yttrium(3+) |
| SMILES | CC1CCC(CCc2cc(F)c(-c3cc(F)[c-]c(F)c3)c(F)c2)CC1.[Y+3] |
| InChI | InChI=1S/C21H21F4.Y/c1-13-2-4-14(5-3-13)6-7-15-8-19(24)21(20(25)9-15)16-10-17(22)12-18(23)11-16;/h8-11,13-14H,2-7H2,1H3;/q-1;+3 |
| InChIKey | VBNWJINHULSISK-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|