C35H42ClF3 — CID 54363230
2-(4-chloro-3-fluorophenyl)-1,3-difluoro-5-[2-[4-[2-(4-heptylphenyl)ethyl]cyclohexyl]ethyl]benzene (PubChem CID 54363230) has the molecular formula C35H42ClF3 and a molecular weight of 555.17 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-1,3-difluoro-5-[2-[4-[2-(4-heptylphenyl)ethyl]cyclohexyl]ethyl]benzene.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-1,3-difluoro-5-[2-[4-[2-(4-heptylphenyl)ethyl]cyclohexyl]ethyl]benzene |
|---|---|
| PubChem CID | 54363230 |
| Molecular Formula | C35H42ClF3 |
| Molecular Weight | 555.17 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-1,3-difluoro-5-[2-[4-[2-(4-heptylphenyl)ethyl]cyclohexyl]ethyl]benzene |
| SMILES | CCCCCCCc1ccc(CCC2CCC(CCc3cc(F)c(-c4ccc(Cl)c(F)c4)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C35H42ClF3/c1-2-3-4-5-6-7-25-8-10-26(11-9-25)12-13-27-14-16-28(17-15-27)18-19-29-22-33(38)35(34(39)23-29)30-20-21-31(36)32(37)24-30/h8-11,20-24,27-28H,2-7,12-19H2,1H3 |
| InChIKey | UNYPKZJITOACNZ-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.17 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|